C13H21N6O2+ — CID 6950434
1,3,7-trimethyl-8-(4-methylpiperazin-4-ium-1-yl)purine-2,6-dione (PubChem CID 6950434) has the molecular formula C13H21N6O2+ and a molecular weight of 293.35 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-(4-methylpiperazin-4-ium-1-yl)purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-(4-methylpiperazin-4-ium-1-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 6950434 |
| Molecular Formula | C13H21N6O2+ |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1,3,7-trimethyl-8-(4-methylpiperazin-4-ium-1-yl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CC[NH+](C)CC3)n2C)n(C)c1=O |
| InChI | InChI=1S/C13H20N6O2/c1-15-5-7-19(8-6-15)12-14-10-9(16(12)2)11(20)18(4)13(21)17(10)3/h5-8H2,1-4H3/p+1 |
| InChIKey | YLHRFCKMKMMSBZ-UHFFFAOYSA-O |
| XLogP | -2.69 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |