C22H35FN6O2 — CID 143035282
ethane;(3E,5Z)-4-fluorohepta-1,3,5-triene;1,3,7-trimethyl-8-(4-methylpiperazin-1-yl)purine-2,6-dione (PubChem CID 143035282) has the molecular formula C22H35FN6O2 and a molecular weight of 434.56 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-fluorohepta-1,3,5-triene;1,3,7-trimethyl-8-(4-methylpiperazin-1-yl)purine-2,6-dione.
| Compound Name | ethane;(3E,5Z)-4-fluorohepta-1,3,5-triene;1,3,7-trimethyl-8-(4-methylpiperazin-1-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 143035282 |
| Molecular Formula | C22H35FN6O2 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | ethane;(3E,5Z)-4-fluorohepta-1,3,5-triene;1,3,7-trimethyl-8-(4-methylpiperazin-1-yl)purine-2,6-dione |
| SMILES | C=C/C=C(F)\C=C/C.CC.CN1CCN(c2nc3c(c(=O)n(C)c(=O)n3C)n2C)CC1 |
| InChI | InChI=1S/C13H20N6O2.C7H9F.C2H6/c1-15-5-7-19(8-6-15)12-14-10-9(16(12)2)11(20)18(4)13(21)17(10)3;1-3-5-7(8)6-4-2;1-2/h5-8H2,1-4H3;3-6H,1H2,2H3;1-2H3/b;6-4-,7-5+; |
| InChIKey | CSJJCHVCFQCUFS-HHEXBWDDSA-N |
| XLogP | 2.35 |
| TPSA | 68.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|