C13H18N4O4 — CID 82464889
3-butan-2-yl-7-ethyl-1-methyl-2,6-dioxopurine-8-carboxylic acid (PubChem CID 82464889) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-butan-2-yl-7-ethyl-1-methyl-2,6-dioxopurine-8-carboxylic acid.
| Compound Name | 3-butan-2-yl-7-ethyl-1-methyl-2,6-dioxopurine-8-carboxylic acid |
|---|---|
| PubChem CID | 82464889 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-butan-2-yl-7-ethyl-1-methyl-2,6-dioxopurine-8-carboxylic acid |
| SMILES | CCC(C)n1c(=O)n(C)c(=O)c2c1nc(C(=O)O)n2CC |
| InChI | InChI=1S/C13H18N4O4/c1-5-7(3)17-9-8(11(18)15(4)13(17)21)16(6-2)10(14-9)12(19)20/h7H,5-6H2,1-4H3,(H,19,20) |
| InChIKey | HJSJCJKYBRPCLR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |