C11H10N4O2S — CID 53499822
4-[(4-methyl-1,2,4-triazol-3-yl)sulfonylmethyl]benzonitrile (PubChem CID 53499822) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonylmethyl]benzonitrile.
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonylmethyl]benzonitrile |
|---|---|
| PubChem CID | 53499822 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonylmethyl]benzonitrile |
| SMILES | Cn1cnnc1S(=O)(=O)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C11H10N4O2S/c1-15-8-13-14-11(15)18(16,17)7-10-4-2-9(6-12)3-5-10/h2-5,8H,7H2,1H3 |
| InChIKey | DHGMGALCMYJTTN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 88.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |