C12H15N3O3S — CID 47217757
3-[(2-ethoxyphenyl)methylsulfonyl]-4-methyl-1,2,4-triazole (PubChem CID 47217757) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-[(2-ethoxyphenyl)methylsulfonyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[(2-ethoxyphenyl)methylsulfonyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 47217757 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-[(2-ethoxyphenyl)methylsulfonyl]-4-methyl-1,2,4-triazole |
| SMILES | CCOc1ccccc1CS(=O)(=O)c1nncn1C |
| InChI | InChI=1S/C12H15N3O3S/c1-3-18-11-7-5-4-6-10(11)8-19(16,17)12-14-13-9-15(12)2/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | VQPFVIKVPOUGRX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |