C15H15N3O3S — CID 67907088
2-[(2-ethoxyphenyl)methylsulfonyl]-3H-imidazo[4,5-c]pyridine (PubChem CID 67907088) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-[(2-ethoxyphenyl)methylsulfonyl]-3H-imidazo[4,5-c]pyridine.
| Compound Name | 2-[(2-ethoxyphenyl)methylsulfonyl]-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 67907088 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-[(2-ethoxyphenyl)methylsulfonyl]-3H-imidazo[4,5-c]pyridine |
| SMILES | CCOc1ccccc1CS(=O)(=O)c1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C15H15N3O3S/c1-2-21-14-6-4-3-5-11(14)10-22(19,20)15-17-12-7-8-16-9-13(12)18-15/h3-9H,2,10H2,1H3,(H,17,18) |
| InChIKey | CJANMAMZTPRSAH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |