C17H21N3O4S — CID 22299839
2-[(2-ethoxyphenyl)methylsulfonylamino]-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 22299839) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[(2-ethoxyphenyl)methylsulfonylamino]-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-[(2-ethoxyphenyl)methylsulfonylamino]-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 22299839 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[(2-ethoxyphenyl)methylsulfonylamino]-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | CCOc1ccccc1CS(=O)(=O)NCC(=O)NCc1ccncc1 |
| InChI | InChI=1S/C17H21N3O4S/c1-2-24-16-6-4-3-5-15(16)13-25(22,23)20-12-17(21)19-11-14-7-9-18-10-8-14/h3-10,20H,2,11-13H2,1H3,(H,19,21) |
| InChIKey | SNYPCTWYQPVCOU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |