C14H14ClN3O3S — CID 112993228
2-[(2-chlorophenyl)sulfonylamino]-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 112993228) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)sulfonylamino]-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-[(2-chlorophenyl)sulfonylamino]-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 112993228 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-[(2-chlorophenyl)sulfonylamino]-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1Cl)NCc1ccncc1 |
| InChI | InChI=1S/C14H14ClN3O3S/c15-12-3-1-2-4-13(12)22(20,21)18-10-14(19)17-9-11-5-7-16-8-6-11/h1-8,18H,9-10H2,(H,17,19) |
| InChIKey | ZKNMQNVSVAZHOJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |