C14H12N4O3S — CID 88979518
2-[(3-methyl-4-nitroso-2-pyridinyl)methylsulfonyl]-1H-benzimidazole (PubChem CID 88979518) has the molecular formula C14H12N4O3S and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-[(3-methyl-4-nitroso-2-pyridinyl)methylsulfonyl]-1H-benzimidazole.
| Compound Name | 2-[(3-methyl-4-nitroso-2-pyridinyl)methylsulfonyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 88979518 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[(3-methyl-4-nitroso-2-pyridinyl)methylsulfonyl]-1H-benzimidazole |
| SMILES | Cc1c(N=O)ccnc1CS(=O)(=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H12N4O3S/c1-9-10(18-19)6-7-15-13(9)8-22(20,21)14-16-11-4-2-3-5-12(11)17-14/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | BCJZAOWPEZYKAB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |