C22H24N4O4S — CID 162474142
2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole (PubChem CID 162474142) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole.
| Compound Name | 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole |
|---|---|
| PubChem CID | 162474142 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole |
| SMILES | COCCCOc1ccnc(CS(=O)(=O)c2nc3ccc(-n4cccc4)cc3[nH]2)c1C |
| InChI | InChI=1S/C22H24N4O4S/c1-16-20(23-9-8-21(16)30-13-5-12-29-2)15-31(27,28)22-24-18-7-6-17(14-19(18)25-22)26-10-3-4-11-26/h3-4,6-11,14H,5,12-13,15H2,1-2H3,(H,24,25) |
| InChIKey | LDUPOGMKPSAGGC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|