C18H22KN3O3S — CID 173145234
potassium;hydride;2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole (PubChem CID 173145234) has the molecular formula C18H22KN3O3S and a molecular weight of 399.56 g/mol. Its IUPAC name is potassium;hydride;2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole.
| Compound Name | potassium;hydride;2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 173145234 |
| Molecular Formula | C18H22KN3O3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | potassium;hydride;2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
| SMILES | COCCCOc1ccnc(CS(=O)c2nc3ccccc3[nH]2)c1C.[H-].[K+] |
| InChI | InChI=1S/C18H21N3O3S.K.H/c1-13-16(19-9-8-17(13)24-11-5-10-23-2)12-25(22)18-20-14-6-3-4-7-15(14)21-18;;/h3-4,6-9H,5,10-12H2,1-2H3,(H,20,21);;/q;+1;-1 |
| InChIKey | RKGZUCDAEYSTHE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|