C17H19N3NaO3S — CID 67620713
CID 67620713 (PubChem CID 67620713) has the molecular formula C17H19N3NaO3S and a molecular weight of 368.41 g/mol.
| Compound Name | CID 67620713 |
|---|---|
| PubChem CID | 67620713 |
| Molecular Formula | C17H19N3NaO3S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | — |
| SMILES | COCCOc1ccnc(CS(=O)c2nc3ccccc3[nH]2)c1C.[Na] |
| InChI | InChI=1S/C17H19N3O3S.Na/c1-12-15(18-8-7-16(12)23-10-9-22-2)11-24(21)17-19-13-5-3-4-6-14(13)20-17;/h3-8H,9-11H2,1-2H3,(H,19,20); |
| InChIKey | YOHYYSXLZHQGFC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|