C18H19F3N3NaO3S — CID 173309556
sodium;hydride;2-[[4-(2-methoxyethoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 173309556) has the molecular formula C18H19F3N3NaO3S and a molecular weight of 437.42 g/mol. Its IUPAC name is sodium;hydride;2-[[4-(2-methoxyethoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | sodium;hydride;2-[[4-(2-methoxyethoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 173309556 |
| Molecular Formula | C18H19F3N3NaO3S |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | sodium;hydride;2-[[4-(2-methoxyethoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | COCCOc1ccnc(CS(=O)c2nc3ccc(C(F)(F)F)cc3[nH]2)c1C.[H-].[Na+] |
| InChI | InChI=1S/C18H18F3N3O3S.Na.H/c1-11-15(22-6-5-16(11)27-8-7-26-2)10-28(25)17-23-13-4-3-12(18(19,20)21)9-14(13)24-17;;/h3-6,9H,7-8,10H2,1-2H3,(H,23,24);;/q;+1;-1 |
| InChIKey | MMJMSYKZBBIDJY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|