C20H26N3NaO3S — CID 173335838
sodium;2-[[4-(2-butan-2-yloxyethoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole;hydride (PubChem CID 173335838) has the molecular formula C20H26N3NaO3S and a molecular weight of 411.50 g/mol. Its IUPAC name is sodium;2-[[4-(2-butan-2-yloxyethoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole;hydride.
| Compound Name | sodium;2-[[4-(2-butan-2-yloxyethoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole;hydride |
|---|---|
| PubChem CID | 173335838 |
| Molecular Formula | C20H26N3NaO3S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | sodium;2-[[4-(2-butan-2-yloxyethoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole;hydride |
| SMILES | CCC(C)OCCOc1ccnc(CS(=O)c2nc3ccccc3[nH]2)c1C.[H-].[Na+] |
| InChI | InChI=1S/C20H25N3O3S.Na.H/c1-4-14(2)25-11-12-26-19-9-10-21-18(15(19)3)13-27(24)20-22-16-7-5-6-8-17(16)23-20;;/h5-10,14H,4,11-13H2,1-3H3,(H,22,23);;/q;+1;-1 |
| InChIKey | FHQHAMIWBBKLLL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|