C18H21N3NaO3S — CID 131849629
C18H21N3NaO3S (PubChem CID 131849629) has the molecular formula C18H21N3NaO3S and a molecular weight of 382.44 g/mol.
| Compound Name | C18H21N3NaO3S |
|---|---|
| PubChem CID | 131849629 |
| Molecular Formula | C18H21N3NaO3S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | — |
| SMILES | COCCCOc1ccnc(C[S@@](=O)c2nc3ccccc3[nH]2)c1C.[Na] |
| InChI | InChI=1S/C18H21N3O3S.Na/c1-13-16(19-9-8-17(13)24-11-5-10-23-2)12-25(22)18-20-14-6-3-4-7-15(14)21-18;/h3-4,6-9H,5,10-12H2,1-2H3,(H,20,21);/t25-;/m1./s1 |
| InChIKey | MLQSMKIAIQJZSZ-VQIWEWKSSA-N |
| XLogP | 2.61 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|