About C18H21N3NaO3S
C18H21N3NaO3S (PubChem CID 131849629) has the molecular formula C18H21N3NaO3S
and a molecular weight of 382.44 g/mol.
Molecular Properties
| Compound Name | C18H21N3NaO3S |
| PubChem CID | 131849629 |
| Molecular Formula | C18H21N3NaO3S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | — |
| SMILES | COCCCOc1ccnc(C[S@@](=O)c2nc3ccccc3[nH]2)c1C.[Na] |
| InChI | InChI=1S/C18H21N3O3S.Na/c1-13-16(19-9-8-17(13)24-11-5-10-23-2)12-25(22)18-20-14-6-3-4-7-15(14)21-18;/h3-4,6-9H,5,10-12H2,1-2H3,(H,20,21);/t25-;/m1./s1 |
| InChIKey | MLQSMKIAIQJZSZ-VQIWEWKSSA-N |
| XLogP | 2.61 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze C18H21N3NaO3S with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of C18H21N3NaO3S?
The IUPAC name of C18H21N3NaO3S (CID 131849629) is not available.
What is the SMILES notation for C18H21N3NaO3S?
The canonical SMILES for C18H21N3NaO3S is COCCCOc1ccnc(C[S@@](=O)c2nc3ccccc3[nH]2)c1C.[Na].
What is the InChIKey of C18H21N3NaO3S?
The InChIKey is MLQSMKIAIQJZSZ-VQIWEWKSSA-N. The full InChI is InChI=1S/C18H21N3O3S.Na/c1-13-16(19-9-8-17(13)24-11-5-10-23-2)12-25(22)18-20-14-6-3-4-7-15(14)21-18;/h3-4,6-9H,5,10-12H2,1-2H3,(H,20,21);/t25-;/m1./s1.
What are the key properties of C18H21N3NaO3S?
C18H21N3NaO3S has a molecular weight of 382.44 g/mol, XLogP of 2.61, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for C18H21N3NaO3S is sourced from PubChem (CID 131849629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).