C18H22N3O4S+ — CID 86340891
2-[(S)-[1-hydroxy-4-(3-methoxypropoxy)-3-methylpyridin-1-ium-2-yl]methylsulfinyl]-1H-benzimidazole (PubChem CID 86340891) has the molecular formula C18H22N3O4S+ and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[(S)-[1-hydroxy-4-(3-methoxypropoxy)-3-methylpyridin-1-ium-2-yl]methylsulfinyl]-1H-benzimidazole.
| Compound Name | 2-[(S)-[1-hydroxy-4-(3-methoxypropoxy)-3-methylpyridin-1-ium-2-yl]methylsulfinyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 86340891 |
| Molecular Formula | C18H22N3O4S+ |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-[(S)-[1-hydroxy-4-(3-methoxypropoxy)-3-methylpyridin-1-ium-2-yl]methylsulfinyl]-1H-benzimidazole |
| SMILES | COCCCOc1cc[n+](O)c(C[S@](=O)c2nc3ccccc3[nH]2)c1C |
| InChI | InChI=1S/C18H22N3O4S/c1-13-16(21(22)9-8-17(13)25-11-5-10-24-2)12-26(23)18-19-14-6-3-4-7-15(14)20-18/h3-4,6-9,22H,5,10-12H2,1-2H3,(H,19,20)/q+1/t26-/m0/s1 |
| InChIKey | ZZMDFVBCCUUUNL-SANMLTNESA-N |
| XLogP | 2.12 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|