C18H20KN3O4S — CID 173088492
potassium;1H-benzimidazol-2-ylsulfinyl-[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methanone;hydride (PubChem CID 173088492) has the molecular formula C18H20KN3O4S and a molecular weight of 413.54 g/mol. Its IUPAC name is potassium;1H-benzimidazol-2-ylsulfinyl-[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methanone;hydride.
| Compound Name | potassium;1H-benzimidazol-2-ylsulfinyl-[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methanone;hydride |
|---|---|
| PubChem CID | 173088492 |
| Molecular Formula | C18H20KN3O4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | potassium;1H-benzimidazol-2-ylsulfinyl-[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methanone;hydride |
| SMILES | COCCCOc1ccnc(C(=O)S(=O)c2nc3ccccc3[nH]2)c1C.[H-].[K+] |
| InChI | InChI=1S/C18H19N3O4S.K.H/c1-12-15(25-11-5-10-24-2)8-9-19-16(12)17(22)26(23)18-20-13-6-3-4-7-14(13)21-18;;/h3-4,6-9H,5,10-11H2,1-2H3,(H,20,21);;/q;+1;-1 |
| InChIKey | RZPUZAUZBLRBCG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|