C21H27N3O3S — CID 91222726
2-[[4-(3-ethoxypropoxy)-3-propan-2-yl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole (PubChem CID 91222726) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-[[4-(3-ethoxypropoxy)-3-propan-2-yl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole.
| Compound Name | 2-[[4-(3-ethoxypropoxy)-3-propan-2-yl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 91222726 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-[[4-(3-ethoxypropoxy)-3-propan-2-yl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
| SMILES | CCOCCCOc1ccnc(CS(=O)c2nc3ccccc3[nH]2)c1C(C)C |
| InChI | InChI=1S/C21H27N3O3S/c1-4-26-12-7-13-27-19-10-11-22-18(20(19)15(2)3)14-28(25)21-23-16-8-5-6-9-17(16)24-21/h5-6,8-11,15H,4,7,12-14H2,1-3H3,(H,23,24) |
| InChIKey | HDXCXORIUSARJU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|