C20H23N3O6S — CID 89258308
[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methyl 6,7-dihydro-1H-furo[2,3-f]benzimidazole-2-sulfonate (PubChem CID 89258308) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is [4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methyl 6,7-dihydro-1H-furo[2,3-f]benzimidazole-2-sulfonate.
| Compound Name | [4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methyl 6,7-dihydro-1H-furo[2,3-f]benzimidazole-2-sulfonate |
|---|---|
| PubChem CID | 89258308 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methyl 6,7-dihydro-1H-furo[2,3-f]benzimidazole-2-sulfonate |
| SMILES | COCCCOc1ccnc(COS(=O)(=O)c2nc3cc4c(cc3[nH]2)CCO4)c1C |
| InChI | InChI=1S/C20H23N3O6S/c1-13-17(21-6-4-18(13)27-8-3-7-26-2)12-29-30(24,25)20-22-15-10-14-5-9-28-19(14)11-16(15)23-20/h4,6,10-11H,3,5,7-9,12H2,1-2H3,(H,22,23) |
| InChIKey | NEGLMMGEMLENRN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|