C16H16ClN2O2S- — CID 21204339
2-(2,4,6-trimethylphenyl)sulfonyl-1H-benzimidazole chloride (PubChem CID 21204339) has the molecular formula C16H16ClN2O2S- and a molecular weight of 335.84 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)sulfonyl-1H-benzimidazole chloride.
| Compound Name | 2-(2,4,6-trimethylphenyl)sulfonyl-1H-benzimidazole chloride |
|---|---|
| PubChem CID | 21204339 |
| Molecular Formula | C16H16ClN2O2S- |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)sulfonyl-1H-benzimidazole chloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2nc3ccccc3[nH]2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C16H16N2O2S.ClH/c1-10-8-11(2)15(12(3)9-10)21(19,20)16-17-13-6-4-5-7-14(13)18-16;/h4-9H,1-3H3,(H,17,18);1H/p-1 |
| InChIKey | XHVOYSYGDWKNQS-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |