C13H10N2NaO3S — CID 57351349
CID 57351349 (PubChem CID 57351349) has the molecular formula C13H10N2NaO3S and a molecular weight of 297.29 g/mol.
| Compound Name | CID 57351349 |
|---|---|
| PubChem CID | 57351349 |
| Molecular Formula | C13H10N2NaO3S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | — |
| SMILES | O=S(=O)(Oc1ccccc1)c1nc2ccccc2[nH]1.[Na] |
| InChI | InChI=1S/C13H10N2O3S.Na/c16-19(17,18-10-6-2-1-3-7-10)13-14-11-8-4-5-9-12(11)15-13;/h1-9H,(H,14,15); |
| InChIKey | WYGAOZZSULVRSS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|