C22H18N4O4S2 — CID 94844754
[3-[(Z)-[[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 94844754) has the molecular formula C22H18N4O4S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is [3-[(Z)-[[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [3-[(Z)-[[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 94844754 |
| Molecular Formula | C22H18N4O4S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [3-[(Z)-[[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)N/N=C\c1cccc(OS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H18N4O4S2/c27-21(15-31-22-24-19-11-4-5-12-20(19)25-22)26-23-14-16-7-6-8-17(13-16)30-32(28,29)18-9-2-1-3-10-18/h1-14H,15H2,(H,24,25)(H,26,27)/b23-14- |
| InChIKey | ZJMIEHGQSBIBPN-UCQKPKSFSA-N |
| XLogP | 3.57 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|