C23H19FN4O2S — CID 39756899
2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 39756899) has the molecular formula C23H19FN4O2S and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 39756899 |
| Molecular Formula | C23H19FN4O2S |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)N/N=C\c1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H19FN4O2S/c24-18-10-8-16(9-11-18)14-30-19-5-3-4-17(12-19)13-25-28-22(29)15-31-23-26-20-6-1-2-7-21(20)27-23/h1-13H,14-15H2,(H,26,27)(H,28,29)/b25-13- |
| InChIKey | ZOQHIZATGLIPRP-MXAYSNPKSA-N |
| XLogP | 4.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|