C25H25N7O6S — CID 146283159
N-[3-(cyclopropanecarbonylamino)-5-[3-(7-methyl-1,1,6,8-tetraoxo-3,4-dihydro-2H-purino[7,8-e][1,2,5]thiadiazin-9-yl)prop-1-ynyl]phenyl]cyclopropanecarboxamide (PubChem CID 146283159) has the molecular formula C25H25N7O6S and a molecular weight of 551.59 g/mol. Its IUPAC name is N-[3-(cyclopropanecarbonylamino)-5-[3-(7-methyl-1,1,6,8-tetraoxo-3,4-dihydro-2H-purino[7,8-e][1,2,5]thiadiazin-9-yl)prop-1-ynyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-(cyclopropanecarbonylamino)-5-[3-(7-methyl-1,1,6,8-tetraoxo-3,4-dihydro-2H-purino[7,8-e][1,2,5]thiadiazin-9-yl)prop-1-ynyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 146283159 |
| Molecular Formula | C25H25N7O6S |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | N-[3-(cyclopropanecarbonylamino)-5-[3-(7-methyl-1,1,6,8-tetraoxo-3,4-dihydro-2H-purino[7,8-e][1,2,5]thiadiazin-9-yl)prop-1-ynyl]phenyl]cyclopropanecarboxamide |
| SMILES | Cn1c(=O)c2c(nc3n2CCNS3(=O)=O)n(CC#Cc2cc(NC(=O)C3CC3)cc(NC(=O)C3CC3)c2)c1=O |
| InChI | InChI=1S/C25H25N7O6S/c1-30-23(35)19-20(29-24-31(19)10-8-26-39(24,37)38)32(25(30)36)9-2-3-14-11-17(27-21(33)15-4-5-15)13-18(12-14)28-22(34)16-6-7-16/h11-13,15-16,26H,4-10H2,1H3,(H,27,33)(H,28,34) |
| InChIKey | HGUVBGIWBKPXLX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 166.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|