C18H19N3O3 — CID 10268194
ethyl 2-[2-(3-acetamidophenyl)ethynyl]-3,5-dimethylimidazole-4-carboxylate (PubChem CID 10268194) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is ethyl 2-[2-(3-acetamidophenyl)ethynyl]-3,5-dimethylimidazole-4-carboxylate.
| Compound Name | ethyl 2-[2-(3-acetamidophenyl)ethynyl]-3,5-dimethylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 10268194 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | ethyl 2-[2-(3-acetamidophenyl)ethynyl]-3,5-dimethylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(C#Cc2cccc(NC(C)=O)c2)n1C |
| InChI | InChI=1S/C18H19N3O3/c1-5-24-18(23)17-12(2)19-16(21(17)4)10-9-14-7-6-8-15(11-14)20-13(3)22/h6-8,11H,5H2,1-4H3,(H,20,22) |
| InChIKey | VPSIUCDDPIYDBZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|