C20H33N7O4 — CID 3226588
N-[2-[[7-[2-(tert-butylamino)-2-oxoethyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]pentanamide (PubChem CID 3226588) has the molecular formula C20H33N7O4 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[2-[[7-[2-(tert-butylamino)-2-oxoethyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]pentanamide.
| Compound Name | N-[2-[[7-[2-(tert-butylamino)-2-oxoethyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]pentanamide |
|---|---|
| PubChem CID | 3226588 |
| Molecular Formula | C20H33N7O4 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | N-[2-[[7-[2-(tert-butylamino)-2-oxoethyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCNc1nc2c(c(=O)n(C)c(=O)n2C)n1CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H33N7O4/c1-7-8-9-13(28)21-10-11-22-18-23-16-15(17(30)26(6)19(31)25(16)5)27(18)12-14(29)24-20(2,3)4/h7-12H2,1-6H3,(H,21,28)(H,22,23)(H,24,29) |
| InChIKey | BDIIXRNRGBUABZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|