C10H16N6O2 — CID 82464557
8-hydrazinyl-1,7-dimethyl-3-propan-2-ylpurine-2,6-dione (PubChem CID 82464557) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 8-hydrazinyl-1,7-dimethyl-3-propan-2-ylpurine-2,6-dione.
| Compound Name | 8-hydrazinyl-1,7-dimethyl-3-propan-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464557 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 8-hydrazinyl-1,7-dimethyl-3-propan-2-ylpurine-2,6-dione |
| SMILES | CC(C)n1c(=O)n(C)c(=O)c2c1nc(NN)n2C |
| InChI | InChI=1S/C10H16N6O2/c1-5(2)16-7-6(8(17)15(4)10(16)18)14(3)9(12-7)13-11/h5H,11H2,1-4H3,(H,12,13) |
| InChIKey | IUZMOHMPPGLSOX-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|