C15H18N6O3 — CID 1402237
8-hydrazinyl-7-[(2R)-2-hydroxy-2-phenylethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 1402237) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is 8-hydrazinyl-7-[(2R)-2-hydroxy-2-phenylethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-hydrazinyl-7-[(2R)-2-hydroxy-2-phenylethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 1402237 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 8-hydrazinyl-7-[(2R)-2-hydroxy-2-phenylethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NN)n2C[C@H](O)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C15H18N6O3/c1-19-12-11(13(23)20(2)15(19)24)21(14(17-12)18-16)8-10(22)9-6-4-3-5-7-9/h3-7,10,22H,8,16H2,1-2H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | VSINNQHQOXIJSC-JTQLQIEISA-N |
| XLogP | -0.55 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|