C12H15N5O2 — CID 51058636
3-(7-ethyl-3,8-dimethyl-2,6-dioxopurin-1-yl)propanenitrile (PubChem CID 51058636) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-(7-ethyl-3,8-dimethyl-2,6-dioxopurin-1-yl)propanenitrile.
| Compound Name | 3-(7-ethyl-3,8-dimethyl-2,6-dioxopurin-1-yl)propanenitrile |
|---|---|
| PubChem CID | 51058636 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-(7-ethyl-3,8-dimethyl-2,6-dioxopurin-1-yl)propanenitrile |
| SMILES | CCn1c(C)nc2c1c(=O)n(CCC#N)c(=O)n2C |
| InChI | InChI=1S/C12H15N5O2/c1-4-16-8(2)14-10-9(16)11(18)17(7-5-6-13)12(19)15(10)3/h4-5,7H2,1-3H3 |
| InChIKey | JFGXVTMADCNZTD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |