C12H20N5O3+ — CID 4005230
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)ethyl-(3-hydroxypropyl)azanium (PubChem CID 4005230) has the molecular formula C12H20N5O3+ and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)ethyl-(3-hydroxypropyl)azanium.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)ethyl-(3-hydroxypropyl)azanium |
|---|---|
| PubChem CID | 4005230 |
| Molecular Formula | C12H20N5O3+ |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)ethyl-(3-hydroxypropyl)azanium |
| SMILES | Cn1cnc2c1c(=O)n(CC[NH2+]CCCO)c(=O)n2C |
| InChI | InChI=1S/C12H19N5O3/c1-15-8-14-10-9(15)11(19)17(12(20)16(10)2)6-5-13-4-3-7-18/h8,13,18H,3-7H2,1-2H3/p+1 |
| InChIKey | FUSQYYGEIKTQFC-UHFFFAOYSA-O |
| XLogP | -2.62 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|