C10H15N8O2+ — CID 7336417
(E)-(diaminomethylideneamino)-[2-(3,7-dimethyl-2,6-dioxopurin-1-yl)ethylidene]azanium (PubChem CID 7336417) has the molecular formula C10H15N8O2+ and a molecular weight of 279.28 g/mol. Its IUPAC name is (E)-(diaminomethylideneamino)-[2-(3,7-dimethyl-2,6-dioxopurin-1-yl)ethylidene]azanium.
| Compound Name | (E)-(diaminomethylideneamino)-[2-(3,7-dimethyl-2,6-dioxopurin-1-yl)ethylidene]azanium |
|---|---|
| PubChem CID | 7336417 |
| Molecular Formula | C10H15N8O2+ |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (E)-(diaminomethylideneamino)-[2-(3,7-dimethyl-2,6-dioxopurin-1-yl)ethylidene]azanium |
| SMILES | Cn1cnc2c1c(=O)n(C/C=[NH+]/N=C(N)N)c(=O)n2C |
| InChI | InChI=1S/C10H14N8O2/c1-16-5-13-7-6(16)8(19)18(10(20)17(7)2)4-3-14-15-9(11)12/h3,5H,4H2,1-2H3,(H4,11,12,15)/p+1/b14-3+ |
| InChIKey | ROSTULATFVLODX-LZWSPWQCSA-O |
| XLogP | -4.23 |
| TPSA | 140.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|