C13H17N5O3S — CID 56797112
3,7-dimethyl-1-(2-oxo-2-thiomorpholin-4-ylethyl)purine-2,6-dione (PubChem CID 56797112) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is 3,7-dimethyl-1-(2-oxo-2-thiomorpholin-4-ylethyl)purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-(2-oxo-2-thiomorpholin-4-ylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 56797112 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 3,7-dimethyl-1-(2-oxo-2-thiomorpholin-4-ylethyl)purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)N1CCSCC1)c(=O)n2C |
| InChI | InChI=1S/C13H17N5O3S/c1-15-8-14-11-10(15)12(20)18(13(21)16(11)2)7-9(19)17-3-5-22-6-4-17/h8H,3-7H2,1-2H3 |
| InChIKey | XFDFIFWKHJKDHG-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |