C18H18N8O8Zn — CID 23043435
zinc bis(2-(1,7-dimethyl-2,6-dioxopurin-3-yl)acetate) (PubChem CID 23043435) has the molecular formula C18H18N8O8Zn and a molecular weight of 539.78 g/mol. Its IUPAC name is zinc bis(2-(1,7-dimethyl-2,6-dioxopurin-3-yl)acetate).
| Compound Name | zinc bis(2-(1,7-dimethyl-2,6-dioxopurin-3-yl)acetate) |
|---|---|
| PubChem CID | 23043435 |
| Molecular Formula | C18H18N8O8Zn |
| Molecular Weight | 539.78 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | zinc bis(2-(1,7-dimethyl-2,6-dioxopurin-3-yl)acetate) |
| SMILES | Cn1c(=O)c2c(ncn2C)n(CC(=O)[O-])c1=O.Cn1c(=O)c2c(ncn2C)n(CC(=O)[O-])c1=O.[Zn+2] |
| InChI | InChI=1S/2C9H10N4O4.Zn/c2*1-11-4-10-7-6(11)8(16)12(2)9(17)13(7)3-5(14)15;/h2*4H,3H2,1-2H3,(H,14,15);/q;;+2/p-2 |
| InChIKey | PJWMQICFYCOKAP-UHFFFAOYSA-L |
| XLogP | -5.64 |
| TPSA | 203.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.78 |
| LogP ≤ 5 | -5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|