C9H10N4O3 — CID 91513962
1,7-dimethyl-3-(oxiran-2-yl)purine-2,6-dione (PubChem CID 91513962) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 1,7-dimethyl-3-(oxiran-2-yl)purine-2,6-dione.
| Compound Name | 1,7-dimethyl-3-(oxiran-2-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 91513962 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1,7-dimethyl-3-(oxiran-2-yl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C2CO2)c1=O |
| InChI | InChI=1S/C9H10N4O3/c1-11-4-10-7-6(11)8(14)12(2)9(15)13(7)5-3-16-5/h4-5H,3H2,1-2H3 |
| InChIKey | IRTRQESBQMLSDY-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 74.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|