C14H16N8O4 — CID 66887227
9-methyl-3H-purine-2,6-dione;1,3,7-trimethylpurine-2,6-dione (PubChem CID 66887227) has the molecular formula C14H16N8O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is 9-methyl-3H-purine-2,6-dione;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 9-methyl-3H-purine-2,6-dione;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 66887227 |
| Molecular Formula | C14H16N8O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 9-methyl-3H-purine-2,6-dione;1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.Cn1cnc2c(=O)[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C8H10N4O2.C6H6N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;1-10-2-7-3-4(10)8-6(12)9-5(3)11/h4H,1-3H3;2H,1H3,(H2,8,9,11,12) |
| InChIKey | BGNUZRIBZFVZFG-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |