C15H24N4O2 — CID 174592039
1-(2,6-dimethylheptan-4-yl)-3-methyl-7H-purine-2,6-dione (PubChem CID 174592039) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-(2,6-dimethylheptan-4-yl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 1-(2,6-dimethylheptan-4-yl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 174592039 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-(2,6-dimethylheptan-4-yl)-3-methyl-7H-purine-2,6-dione |
| SMILES | CC(C)CC(CC(C)C)n1c(=O)c2[nH]cnc2n(C)c1=O |
| InChI | InChI=1S/C15H24N4O2/c1-9(2)6-11(7-10(3)4)19-14(20)12-13(17-8-16-12)18(5)15(19)21/h8-11H,6-7H2,1-5H3,(H,16,17) |
| InChIKey | CLZKMXYJNGHYOF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |