C12H9FN4O2 — CID 141079792
1-[(2-fluorophenyl)methyl]-3,7-dihydropurine-2,6-dione (PubChem CID 141079792) has the molecular formula C12H9FN4O2 and a molecular weight of 260.23 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 1-[(2-fluorophenyl)methyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 141079792 |
| Molecular Formula | C12H9FN4O2 |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c2nc[nH]c2c(=O)n1Cc1ccccc1F |
| InChI | InChI=1S/C12H9FN4O2/c13-8-4-2-1-3-7(8)5-17-11(18)9-10(15-6-14-9)16-12(17)19/h1-4,6H,5H2,(H,14,15)(H,16,19) |
| InChIKey | LMIPBJGNVHPPBV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |