C15H17FN6O — CID 59705205
2-(3-aminopropylamino)-9-[(2-fluorophenyl)methyl]-7H-purin-8-one (PubChem CID 59705205) has the molecular formula C15H17FN6O and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-(3-aminopropylamino)-9-[(2-fluorophenyl)methyl]-7H-purin-8-one.
| Compound Name | 2-(3-aminopropylamino)-9-[(2-fluorophenyl)methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 59705205 |
| Molecular Formula | C15H17FN6O |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-(3-aminopropylamino)-9-[(2-fluorophenyl)methyl]-7H-purin-8-one |
| SMILES | NCCCNc1ncc2[nH]c(=O)n(Cc3ccccc3F)c2n1 |
| InChI | InChI=1S/C15H17FN6O/c16-11-5-2-1-4-10(11)9-22-13-12(20-15(22)23)8-19-14(21-13)18-7-3-6-17/h1-2,4-5,8H,3,6-7,9,17H2,(H,20,23)(H,18,19,21) |
| InChIKey | PWUMYEQHRHWJOR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|