C17H18F4N6O — CID 70951964
2-(4-aminobutylamino)-9-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-7H-purin-8-one (PubChem CID 70951964) has the molecular formula C17H18F4N6O and a molecular weight of 398.36 g/mol. Its IUPAC name is 2-(4-aminobutylamino)-9-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-7H-purin-8-one.
| Compound Name | 2-(4-aminobutylamino)-9-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 70951964 |
| Molecular Formula | C17H18F4N6O |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-(4-aminobutylamino)-9-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-7H-purin-8-one |
| SMILES | NCCCCNc1ncc2[nH]c(=O)n(Cc3cc(F)ccc3C(F)(F)F)c2n1 |
| InChI | InChI=1S/C17H18F4N6O/c18-11-3-4-12(17(19,20)21)10(7-11)9-27-14-13(25-16(27)28)8-24-15(26-14)23-6-2-1-5-22/h3-4,7-8H,1-2,5-6,9,22H2,(H,25,28)(H,23,24,26) |
| InChIKey | LAIVNLBIAWSKJL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|