C20H16BrF3N6O2 — CID 42606279
2-[(4-aminophenyl)methylamino]-9-[[5-bromo-2-(trifluoromethoxy)phenyl]methyl]-7H-purin-8-one (PubChem CID 42606279) has the molecular formula C20H16BrF3N6O2 and a molecular weight of 509.29 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methylamino]-9-[[5-bromo-2-(trifluoromethoxy)phenyl]methyl]-7H-purin-8-one.
| Compound Name | 2-[(4-aminophenyl)methylamino]-9-[[5-bromo-2-(trifluoromethoxy)phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 42606279 |
| Molecular Formula | C20H16BrF3N6O2 |
| Molecular Weight | 509.29 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 2-[(4-aminophenyl)methylamino]-9-[[5-bromo-2-(trifluoromethoxy)phenyl]methyl]-7H-purin-8-one |
| SMILES | Nc1ccc(CNc2ncc3[nH]c(=O)n(Cc4cc(Br)ccc4OC(F)(F)F)c3n2)cc1 |
| InChI | InChI=1S/C20H16BrF3N6O2/c21-13-3-6-16(32-20(22,23)24)12(7-13)10-30-17-15(28-19(30)31)9-27-18(29-17)26-8-11-1-4-14(25)5-2-11/h1-7,9H,8,10,25H2,(H,28,31)(H,26,27,29) |
| InChIKey | LHAGKZLDWJAVQA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|