C18H21F3N6O — CID 70952052
2-(4-aminobutylamino)-9-[[2-(2,2,2-trifluoroethyl)phenyl]methyl]-7H-purin-8-one (PubChem CID 70952052) has the molecular formula C18H21F3N6O and a molecular weight of 394.40 g/mol. Its IUPAC name is 2-(4-aminobutylamino)-9-[[2-(2,2,2-trifluoroethyl)phenyl]methyl]-7H-purin-8-one.
| Compound Name | 2-(4-aminobutylamino)-9-[[2-(2,2,2-trifluoroethyl)phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 70952052 |
| Molecular Formula | C18H21F3N6O |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-(4-aminobutylamino)-9-[[2-(2,2,2-trifluoroethyl)phenyl]methyl]-7H-purin-8-one |
| SMILES | NCCCCNc1ncc2[nH]c(=O)n(Cc3ccccc3CC(F)(F)F)c2n1 |
| InChI | InChI=1S/C18H21F3N6O/c19-18(20,21)9-12-5-1-2-6-13(12)11-27-15-14(25-17(27)28)10-24-16(26-15)23-8-4-3-7-22/h1-2,5-6,10H,3-4,7-9,11,22H2,(H,25,28)(H,23,24,26) |
| InChIKey | FPFVDOBRAGKOBB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|