C21H27ClN6O — CID 59705182
9-[(2-chlorophenyl)methyl]-2-[3-(2-methylpiperidin-1-yl)propylamino]-7H-purin-8-one (PubChem CID 59705182) has the molecular formula C21H27ClN6O and a molecular weight of 414.94 g/mol. Its IUPAC name is 9-[(2-chlorophenyl)methyl]-2-[3-(2-methylpiperidin-1-yl)propylamino]-7H-purin-8-one.
| Compound Name | 9-[(2-chlorophenyl)methyl]-2-[3-(2-methylpiperidin-1-yl)propylamino]-7H-purin-8-one |
|---|---|
| PubChem CID | 59705182 |
| Molecular Formula | C21H27ClN6O |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 9-[(2-chlorophenyl)methyl]-2-[3-(2-methylpiperidin-1-yl)propylamino]-7H-purin-8-one |
| SMILES | CC1CCCCN1CCCNc1ncc2[nH]c(=O)n(Cc3ccccc3Cl)c2n1 |
| InChI | InChI=1S/C21H27ClN6O/c1-15-7-4-5-11-27(15)12-6-10-23-20-24-13-18-19(26-20)28(21(29)25-18)14-16-8-2-3-9-17(16)22/h2-3,8-9,13,15H,4-7,10-12,14H2,1H3,(H,25,29)(H,23,24,26) |
| InChIKey | NBTCDLDWLJBQOW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|