C17H19ClN6O — CID 24821843
9-[(2-chlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one (PubChem CID 24821843) has the molecular formula C17H19ClN6O and a molecular weight of 358.83 g/mol. Its IUPAC name is 9-[(2-chlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one.
| Compound Name | 9-[(2-chlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one |
|---|---|
| PubChem CID | 24821843 |
| Molecular Formula | C17H19ClN6O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 9-[(2-chlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(NC[C@H]3CCNC3)nc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN6O/c18-13-4-2-1-3-12(13)10-24-15-14(22-17(24)25)9-21-16(23-15)20-8-11-5-6-19-7-11/h1-4,9,11,19H,5-8,10H2,(H,22,25)(H,20,21,23)/t11-/m0/s1 |
| InChIKey | SANYGEPWKJGSMY-NSHDSACASA-N |
| XLogP | 1.84 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |