C23H22Cl2N6 — CID 58155715
N-benzyl-8-(2,6-dichlorophenyl)-9-[[(3S)-pyrrolidin-3-yl]methyl]purin-2-amine (PubChem CID 58155715) has the molecular formula C23H22Cl2N6 and a molecular weight of 453.38 g/mol. Its IUPAC name is N-benzyl-8-(2,6-dichlorophenyl)-9-[[(3S)-pyrrolidin-3-yl]methyl]purin-2-amine.
| Compound Name | N-benzyl-8-(2,6-dichlorophenyl)-9-[[(3S)-pyrrolidin-3-yl]methyl]purin-2-amine |
|---|---|
| PubChem CID | 58155715 |
| Molecular Formula | C23H22Cl2N6 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-benzyl-8-(2,6-dichlorophenyl)-9-[[(3S)-pyrrolidin-3-yl]methyl]purin-2-amine |
| SMILES | Clc1cccc(Cl)c1-c1nc2cnc(NCc3ccccc3)nc2n1C[C@H]1CCNC1 |
| InChI | InChI=1S/C23H22Cl2N6/c24-17-7-4-8-18(25)20(17)22-29-19-13-28-23(27-12-15-5-2-1-3-6-15)30-21(19)31(22)14-16-9-10-26-11-16/h1-8,13,16,26H,9-12,14H2,(H,27,28,30)/t16-/m0/s1 |
| InChIKey | RYBQALLKRBUDRK-INIZCTEOSA-N |
| XLogP | 5.02 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |