C25H26Cl2N6 — CID 58155633
N-benzyl-8-(2,6-dichlorophenyl)-9-(2-piperidin-4-ylethyl)purin-2-amine (PubChem CID 58155633) has the molecular formula C25H26Cl2N6 and a molecular weight of 481.43 g/mol. Its IUPAC name is N-benzyl-8-(2,6-dichlorophenyl)-9-(2-piperidin-4-ylethyl)purin-2-amine.
| Compound Name | N-benzyl-8-(2,6-dichlorophenyl)-9-(2-piperidin-4-ylethyl)purin-2-amine |
|---|---|
| PubChem CID | 58155633 |
| Molecular Formula | C25H26Cl2N6 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-benzyl-8-(2,6-dichlorophenyl)-9-(2-piperidin-4-ylethyl)purin-2-amine |
| SMILES | Clc1cccc(Cl)c1-c1nc2cnc(NCc3ccccc3)nc2n1CCC1CCNCC1 |
| InChI | InChI=1S/C25H26Cl2N6/c26-19-7-4-8-20(27)22(19)24-31-21-16-30-25(29-15-18-5-2-1-3-6-18)32-23(21)33(24)14-11-17-9-12-28-13-10-17/h1-8,16-17,28H,9-15H2,(H,29,30,32) |
| InChIKey | HNOFWGPQTTXRRU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |