C24H24ClFN6 — CID 70794272
8-(2-chloro-6-fluorophenyl)-N-[(1S)-1-phenylethyl]-9-(pyrrolidin-3-ylmethyl)purin-2-amine (PubChem CID 70794272) has the molecular formula C24H24ClFN6 and a molecular weight of 450.95 g/mol. Its IUPAC name is 8-(2-chloro-6-fluorophenyl)-N-[(1S)-1-phenylethyl]-9-(pyrrolidin-3-ylmethyl)purin-2-amine.
| Compound Name | 8-(2-chloro-6-fluorophenyl)-N-[(1S)-1-phenylethyl]-9-(pyrrolidin-3-ylmethyl)purin-2-amine |
|---|---|
| PubChem CID | 70794272 |
| Molecular Formula | C24H24ClFN6 |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 8-(2-chloro-6-fluorophenyl)-N-[(1S)-1-phenylethyl]-9-(pyrrolidin-3-ylmethyl)purin-2-amine |
| SMILES | C[C@H](Nc1ncc2nc(-c3c(F)cccc3Cl)n(CC3CCNC3)c2n1)c1ccccc1 |
| InChI | InChI=1S/C24H24ClFN6/c1-15(17-6-3-2-4-7-17)29-24-28-13-20-22(31-24)32(14-16-10-11-27-12-16)23(30-20)21-18(25)8-5-9-19(21)26/h2-9,13,15-16,27H,10-12,14H2,1H3,(H,28,29,31)/t15-,16?/m0/s1 |
| InChIKey | ACSZPBIRMLFHHT-VYRBHSGPSA-N |
| XLogP | 5.07 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |