C21H26F3N7O2 — CID 70952013
9-[[5-(propan-2-ylamino)-2-(trifluoromethoxy)phenyl]methyl]-2-[[(3R)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one (PubChem CID 70952013) has the molecular formula C21H26F3N7O2 and a molecular weight of 465.48 g/mol. Its IUPAC name is 9-[[5-(propan-2-ylamino)-2-(trifluoromethoxy)phenyl]methyl]-2-[[(3R)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one.
| Compound Name | 9-[[5-(propan-2-ylamino)-2-(trifluoromethoxy)phenyl]methyl]-2-[[(3R)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one |
|---|---|
| PubChem CID | 70952013 |
| Molecular Formula | C21H26F3N7O2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 9-[[5-(propan-2-ylamino)-2-(trifluoromethoxy)phenyl]methyl]-2-[[(3R)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one |
| SMILES | CC(C)Nc1ccc(OC(F)(F)F)c(Cn2c(=O)[nH]c3cnc(NC[C@@H]4CCNC4)nc32)c1 |
| InChI | InChI=1S/C21H26F3N7O2/c1-12(2)28-15-3-4-17(33-21(22,23)24)14(7-15)11-31-18-16(29-20(31)32)10-27-19(30-18)26-9-13-5-6-25-8-13/h3-4,7,10,12-13,25,28H,5-6,8-9,11H2,1-2H3,(H,29,32)(H,26,27,30)/t13-/m1/s1 |
| InChIKey | DDCUQRBKFKOQFE-CYBMUJFWSA-N |
| XLogP | 2.91 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|