C15H15FN6O3 — CID 141079807
3-[1-[(2-fluorophenyl)methyl]-2,6-dioxo-7H-purin-3-yl]propanehydrazide (PubChem CID 141079807) has the molecular formula C15H15FN6O3 and a molecular weight of 346.32 g/mol. Its IUPAC name is 3-[1-[(2-fluorophenyl)methyl]-2,6-dioxo-7H-purin-3-yl]propanehydrazide.
| Compound Name | 3-[1-[(2-fluorophenyl)methyl]-2,6-dioxo-7H-purin-3-yl]propanehydrazide |
|---|---|
| PubChem CID | 141079807 |
| Molecular Formula | C15H15FN6O3 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-[1-[(2-fluorophenyl)methyl]-2,6-dioxo-7H-purin-3-yl]propanehydrazide |
| SMILES | NNC(=O)CCn1c(=O)n(Cc2ccccc2F)c(=O)c2[nH]cnc21 |
| InChI | InChI=1S/C15H15FN6O3/c16-10-4-2-1-3-9(10)7-22-14(24)12-13(19-8-18-12)21(15(22)25)6-5-11(23)20-17/h1-4,8H,5-7,17H2,(H,18,19)(H,20,23) |
| InChIKey | JIJYQAHPMFRMET-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|