C15H10FNO3 — CID 11747669
3-(3-fluorophenyl)-6-methyl-1,3-benzoxazine-2,4-dione (PubChem CID 11747669) has the molecular formula C15H10FNO3 and a molecular weight of 271.25 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-6-methyl-1,3-benzoxazine-2,4-dione.
| Compound Name | 3-(3-fluorophenyl)-6-methyl-1,3-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 11747669 |
| Molecular Formula | C15H10FNO3 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-(3-fluorophenyl)-6-methyl-1,3-benzoxazine-2,4-dione |
| SMILES | Cc1ccc2oc(=O)n(-c3cccc(F)c3)c(=O)c2c1 |
| InChI | InChI=1S/C15H10FNO3/c1-9-5-6-13-12(7-9)14(18)17(15(19)20-13)11-4-2-3-10(16)8-11/h2-8H,1H3 |
| InChIKey | JBXWVHGNJYYFAO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |