C15H11FN2O2 — CID 56697661
3-(3-fluorophenyl)-1-methylquinazoline-2,4-dione (PubChem CID 56697661) has the molecular formula C15H11FN2O2 and a molecular weight of 270.26 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-methylquinazoline-2,4-dione.
| Compound Name | 3-(3-fluorophenyl)-1-methylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 56697661 |
| Molecular Formula | C15H11FN2O2 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-(3-fluorophenyl)-1-methylquinazoline-2,4-dione |
| SMILES | Cn1c(=O)n(-c2cccc(F)c2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C15H11FN2O2/c1-17-13-8-3-2-7-12(13)14(19)18(15(17)20)11-6-4-5-10(16)9-11/h2-9H,1H3 |
| InChIKey | PKNWPQKUZRVMLV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |